C15H22O3 — CID 162888817
(3R,3aR,6S,6aS,9aR,9bS)-3,6,9a-trimethyl-3a,4,5,6,6a,7,8,9b-octahydro-3H-azuleno[8,7-b]furan-2,9-dione (PubChem CID 162888817) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,3aR,6S,6aS,9aR,9bS)-3,6,9a-trimethyl-3a,4,5,6,6a,7,8,9b-octahydro-3H-azuleno[8,7-b]furan-2,9-dione.
| Compound Name | (3R,3aR,6S,6aS,9aR,9bS)-3,6,9a-trimethyl-3a,4,5,6,6a,7,8,9b-octahydro-3H-azuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 162888817 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R,3aR,6S,6aS,9aR,9bS)-3,6,9a-trimethyl-3a,4,5,6,6a,7,8,9b-octahydro-3H-azuleno[8,7-b]furan-2,9-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](C)C(=O)O[C@@H]2[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-8-4-5-10-9(2)14(17)18-13(10)15(3)11(8)6-7-12(15)16/h8-11,13H,4-7H2,1-3H3/t8-,9+,10+,11-,13-,15-/m0/s1 |
| InChIKey | UAISWGZBKOGPML-JTVDQKQESA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |