C27H42O5 — CID 162888827
2,3,14-trihydroxy-17-(6-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 162888827) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is 2,3,14-trihydroxy-17-(6-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | 2,3,14-trihydroxy-17-(6-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 162888827 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2,3,14-trihydroxy-17-(6-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(CCCC(C)(C)O)C1CCC2(O)C3=CC(=O)C4=CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C27H42O5/c1-16(7-6-10-24(2,3)31)17-9-12-27(32)19-13-21(28)20-14-22(29)23(30)15-25(20,4)18(19)8-11-26(17,27)5/h13-14,16-18,22-23,29-32H,6-12,15H2,1-5H3 |
| InChIKey | HRSCYVHZLUCLNT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |