C18H24O10 — CID 162888879
[(2S,3S)-2-[(E,1R,4R,5S,6S)-4,6-diacetyloxy-1,5-dihydroxyhept-2-enyl]-6-oxo-2,3-dihydropyran-3-yl] acetate (PubChem CID 162888879) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(2S,3S)-2-[(E,1R,4R,5S,6S)-4,6-diacetyloxy-1,5-dihydroxyhept-2-enyl]-6-oxo-2,3-dihydropyran-3-yl] acetate.
| Compound Name | [(2S,3S)-2-[(E,1R,4R,5S,6S)-4,6-diacetyloxy-1,5-dihydroxyhept-2-enyl]-6-oxo-2,3-dihydropyran-3-yl] acetate |
|---|---|
| PubChem CID | 162888879 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(2S,3S)-2-[(E,1R,4R,5S,6S)-4,6-diacetyloxy-1,5-dihydroxyhept-2-enyl]-6-oxo-2,3-dihydropyran-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@H](O)[C@@H](/C=C/[C@@H](O)[C@@H]1OC(=O)C=C[C@@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H24O10/c1-9(25-10(2)19)17(24)14(26-11(3)20)6-5-13(22)18-15(27-12(4)21)7-8-16(23)28-18/h5-9,13-15,17-18,22,24H,1-4H3/b6-5+/t9-,13+,14+,15-,17-,18-/m0/s1 |
| InChIKey | HRTCWLFNWYFKGZ-ACJNCMIJSA-N |
| XLogP | -0.44 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|