C15H16BrClO2 — CID 162889605
(1S,3S,5E,6R,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1S)-1-chloropent-2-en-4-ynyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane (PubChem CID 162889605) has the molecular formula C15H16BrClO2 and a molecular weight of 343.65 g/mol. Its IUPAC name is (1S,3S,5E,6R,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1S)-1-chloropent-2-en-4-ynyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane.
| Compound Name | (1S,3S,5E,6R,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1S)-1-chloropent-2-en-4-ynyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane |
|---|---|
| PubChem CID | 162889605 |
| Molecular Formula | C15H16BrClO2 |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (1S,3S,5E,6R,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1S)-1-chloropent-2-en-4-ynyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane |
| SMILES | C#C/C=C\[C@H](Cl)[C@@H]1[C@H]2/C(=C(\Br)CC)O[C@H]3C[C@@H]1O[C@@H]23 |
| InChI | InChI=1S/C15H16BrClO2/c1-3-5-6-9(17)12-10-7-11-15(18-10)13(12)14(19-11)8(16)4-2/h1,5-6,9-13,15H,4,7H2,2H3/b6-5-,14-8+/t9-,10-,11-,12-,13-,15+/m0/s1 |
| InChIKey | AYFFHUILZXJDLN-ALMUKOJGSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|