C21H34O5 — CID 162889919
(4S,5S,7S,9R,10S,11E,13E,15S,16R)-16-ethyl-4,10-dihydroxy-5,7,9,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 162889919) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (4S,5S,7S,9R,10S,11E,13E,15S,16R)-16-ethyl-4,10-dihydroxy-5,7,9,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,5S,7S,9R,10S,11E,13E,15S,16R)-16-ethyl-4,10-dihydroxy-5,7,9,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 162889919 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (4S,5S,7S,9R,10S,11E,13E,15S,16R)-16-ethyl-4,10-dihydroxy-5,7,9,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC[C@H]1OC(=O)C[C@H](O)[C@H](C)C(=O)[C@@H](C)C[C@@H](C)[C@H](O)/C=C/C=C/[C@@H]1C |
| InChI | InChI=1S/C21H34O5/c1-6-19-13(2)9-7-8-10-17(22)14(3)11-15(4)21(25)16(5)18(23)12-20(24)26-19/h7-10,13-19,22-23H,6,11-12H2,1-5H3/b9-7+,10-8+/t13-,14+,15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | FREPAPPMSLOSTN-XSRVFPJRSA-N |
| XLogP | 3.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |