C38H40O8 — CID 162889992
5-hydroxy-7-[(4S)-5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl]-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one (PubChem CID 162889992) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is 5-hydroxy-7-[(4S)-5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl]-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one.
| Compound Name | 5-hydroxy-7-[(4S)-5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl]-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 162889992 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 5-hydroxy-7-[(4S)-5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl]-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one |
| SMILES | C=CC(C)(C)c1c2c(c(O)c3cc([C@H]4CC(C)(C)Oc5c4c(O)c4ccc(=O)oc4c5C(C)(C)C=C)c(=O)oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C38H40O8/c1-11-35(3,4)26-31-22(28(40)20-15-16-37(7,8)45-32(20)26)17-21(34(42)44-31)23-18-38(9,10)46-33-25(23)29(41)19-13-14-24(39)43-30(19)27(33)36(5,6)12-2/h11-17,23,40-41H,1-2,18H2,3-10H3/t23-/m1/s1 |
| InChIKey | FURJBUFALVRNOD-HSZRJFAPSA-N |
| XLogP | 8.11 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|