C20H24O6 — CID 162890220
4'-(furan-3-ylmethyl)-3a-hydroxy-5,7a,7b-trimethylspiro[2,3,5,6-tetrahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxetane]-2',7-dione (PubChem CID 162890220) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4'-(furan-3-ylmethyl)-3a-hydroxy-5,7a,7b-trimethylspiro[2,3,5,6-tetrahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxetane]-2',7-dione.
| Compound Name | 4'-(furan-3-ylmethyl)-3a-hydroxy-5,7a,7b-trimethylspiro[2,3,5,6-tetrahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxetane]-2',7-dione |
|---|---|
| PubChem CID | 162890220 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4'-(furan-3-ylmethyl)-3a-hydroxy-5,7a,7b-trimethylspiro[2,3,5,6-tetrahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxetane]-2',7-dione |
| SMILES | CC1CC(=O)C2(C)C3(C)OC3CCC2(O)C12C(=O)OC2Cc1ccoc1 |
| InChI | InChI=1S/C20H24O6/c1-11-8-13(21)17(2)18(3)14(26-18)4-6-19(17,23)20(11)15(25-16(20)22)9-12-5-7-24-10-12/h5,7,10-11,14-15,23H,4,6,8-9H2,1-3H3 |
| InChIKey | JIOWDKSKWPTSCY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|