About [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate
[(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate (PubChem CID 162890296) has the molecular formula C17H24O5
and a molecular weight of 308.37 g/mol. Its IUPAC name is [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate.
Molecular Properties
| Compound Name | [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate |
| PubChem CID | 162890296 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)/C=C(/C)CCCC1=CC(=O)OC1)C(C)C |
| InChI | InChI=1S/C17H24O5/c1-11(2)17(22-13(4)18)15(19)8-12(3)6-5-7-14-9-16(20)21-10-14/h8-9,11,17H,5-7,10H2,1-4H3/b12-8-/t17-/m0/s1 |
| InChIKey | PZQFQAIOCONHRH-UEOUDEGLSA-N |
| XLogP | 2.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate?
The IUPAC name of [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate (CID 162890296) is [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate.
What is the SMILES notation for [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate?
The canonical SMILES for [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate is CC(=O)O[C@H](C(=O)/C=C(/C)CCCC1=CC(=O)OC1)C(C)C.
What is the InChIKey of [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate?
The InChIKey is PZQFQAIOCONHRH-UEOUDEGLSA-N. The full InChI is InChI=1S/C17H24O5/c1-11(2)17(22-13(4)18)15(19)8-12(3)6-5-7-14-9-16(20)21-10-14/h8-9,11,17H,5-7,10H2,1-4H3/b12-8-/t17-/m0/s1.
What are the key properties of [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate?
[(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate has a molecular weight of 308.37 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,3S)-2,6-dimethyl-4-oxo-9-(5-oxo-2H-furan-3-yl)non-5-en-3-yl] acetate is sourced from PubChem (CID 162890296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).