C20H28O5 — CID 162890348
(1R,2E,6S,8S,11E)-1-hydroperoxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one (PubChem CID 162890348) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1R,2E,6S,8S,11E)-1-hydroperoxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one.
| Compound Name | (1R,2E,6S,8S,11E)-1-hydroperoxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one |
|---|---|
| PubChem CID | 162890348 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1R,2E,6S,8S,11E)-1-hydroperoxy-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one |
| SMILES | CC1=C2CC/C(C)=C/CC[C@]3(C)O[C@H]3CC/C(C)=C/[C@]2(OO)OC1=O |
| InChI | InChI=1S/C20H28O5/c1-13-6-5-11-19(4)17(23-19)10-8-14(2)12-20(25-22)16(9-7-13)15(3)18(21)24-20/h6,12,17,22H,5,7-11H2,1-4H3/b13-6+,14-12+/t17-,19-,20+/m0/s1 |
| InChIKey | DVNVQQSZABWHRN-HJSFIQMLSA-N |
| XLogP | 4.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|