C34H58 — CID 162890398
(3R,5R,6R)-5-[(3S,4E,6S,9R,13R)-6-ethenyl-3,6,9,13,14-pentamethyl-10-methylidenepentadeca-4,14-dienyl]-1,3,4,4,6-pentamethylcyclohexene (PubChem CID 162890398) has the molecular formula C34H58 and a molecular weight of 466.84 g/mol. Its IUPAC name is (3R,5R,6R)-5-[(3S,4E,6S,9R,13R)-6-ethenyl-3,6,9,13,14-pentamethyl-10-methylidenepentadeca-4,14-dienyl]-1,3,4,4,6-pentamethylcyclohexene.
| Compound Name | (3R,5R,6R)-5-[(3S,4E,6S,9R,13R)-6-ethenyl-3,6,9,13,14-pentamethyl-10-methylidenepentadeca-4,14-dienyl]-1,3,4,4,6-pentamethylcyclohexene |
|---|---|
| PubChem CID | 162890398 |
| Molecular Formula | C34H58 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.45 |
| IUPAC Name | (3R,5R,6R)-5-[(3S,4E,6S,9R,13R)-6-ethenyl-3,6,9,13,14-pentamethyl-10-methylidenepentadeca-4,14-dienyl]-1,3,4,4,6-pentamethylcyclohexene |
| SMILES | C=C[C@@](C)(/C=C/[C@@H](C)CC[C@@H]1[C@@H](C)C(C)=C[C@@H](C)C1(C)C)CC[C@@H](C)C(=C)CC[C@@H](C)C(=C)C |
| InChI | InChI=1S/C34H58/c1-14-34(13,22-20-28(7)27(6)17-16-26(5)24(2)3)21-19-25(4)15-18-32-31(10)29(8)23-30(9)33(32,11)12/h14,19,21,23,25-26,28,30-32H,1-2,6,15-18,20,22H2,3-5,7-13H3/b21-19+/t25-,26+,28+,30+,31-,32+,34-/m0/s1 |
| InChIKey | JJHOPTZCHYMWTG-NTRGTNEKSA-N |
| XLogP | 10.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|