C30H54O4 — CID 162890699
(3S,6S,7S,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-10,14,18,22-tetraene-2,3,6,7-tetrol (PubChem CID 162890699) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is (3S,6S,7S,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-10,14,18,22-tetraene-2,3,6,7-tetrol.
| Compound Name | (3S,6S,7S,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-10,14,18,22-tetraene-2,3,6,7-tetrol |
|---|---|
| PubChem CID | 162890699 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | (3S,6S,7S,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-10,14,18,22-tetraene-2,3,6,7-tetrol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@H](O)[C@@](C)(O)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H54O4/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-20-28(32)30(8,34)22-21-27(31)29(6,7)33/h13-15,18,27-28,31-34H,9-12,16-17,19-22H2,1-8H3/b24-14+,25-18+,26-15+/t27-,28-,30-/m0/s1 |
| InChIKey | ILPRRIDIERTIPO-ALYQLORNSA-N |
| XLogP | 6.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|