C20H32O2 — CID 162890852
(1S,3aE,6Z,10S,10aR)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-1-ol (PubChem CID 162890852) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3aE,6Z,10S,10aR)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-1-ol.
| Compound Name | (1S,3aE,6Z,10S,10aR)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-1-ol |
|---|---|
| PubChem CID | 162890852 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3aE,6Z,10S,10aR)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-1-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC/C(C)=C\C/C=C2/CO[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H32O2/c1-14(2)7-5-9-16(4)18-12-11-15(3)8-6-10-17-13-22-20(21)19(17)18/h7-8,10,16,18-21H,5-6,9,11-13H2,1-4H3/b15-8-,17-10-/t16-,18+,19+,20+/m1/s1 |
| InChIKey | GKHAFWZZEBWQKT-WZFCUJLCSA-N |
| XLogP | 5.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|