C19H27NO — CID 162891757
(2S,6R,10R,11S)-11-buta-1,3-dienyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol (PubChem CID 162891757) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (2S,6R,10R,11S)-11-buta-1,3-dienyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol.
| Compound Name | (2S,6R,10R,11S)-11-buta-1,3-dienyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 162891757 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (2S,6R,10R,11S)-11-buta-1,3-dienyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol |
| SMILES | C#CC=CC[C@@H]1CCC[C@]2(CCC[C@@H](O)[C@H]2C=CC=C)N1 |
| InChI | InChI=1S/C19H27NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h1,4-7,12,16-18,20-21H,2,8-11,13-15H2/t16-,17-,18-,19-/m1/s1 |
| InChIKey | FQIWPVJJYOOITJ-NCXUSEDFSA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|