C22H24N2O2S2 — CID 162891771
N-[4-hydroxy-4-methyl-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)piperidin-3-yl]benzamide (PubChem CID 162891771) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-hydroxy-4-methyl-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)piperidin-3-yl]benzamide.
| Compound Name | N-[4-hydroxy-4-methyl-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 162891771 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[4-hydroxy-4-methyl-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)piperidin-3-yl]benzamide |
| SMILES | CC1(O)CCN(Cc2cccs2)C(c2cccs2)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2S2/c1-22(26)11-12-24(15-17-9-5-13-27-17)19(18-10-6-14-28-18)20(22)23-21(25)16-7-3-2-4-8-16/h2-10,13-14,19-20,26H,11-12,15H2,1H3,(H,23,25) |
| InChIKey | DBVBYIPCGUHEHM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |