About (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one
(6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one (PubChem CID 162891934) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one.
Molecular Properties
| Compound Name | (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one |
| PubChem CID | 162891934 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one |
| SMILES | COC1=CCO[C@@](C)(OC)C1=O |
| InChI | InChI=1S/C8H12O4/c1-8(11-3)7(9)6(10-2)4-5-12-8/h4H,5H2,1-3H3/t8-/m1/s1 |
| InChIKey | LZDYFHFYJDDHCQ-MRVPVSSYSA-N |
| XLogP | 0.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one?
The IUPAC name of (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one (CID 162891934) is (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one.
What is the SMILES notation for (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one?
The canonical SMILES for (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one is COC1=CCO[C@@](C)(OC)C1=O.
What is the InChIKey of (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one?
The InChIKey is LZDYFHFYJDDHCQ-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12O4/c1-8(11-3)7(9)6(10-2)4-5-12-8/h4H,5H2,1-3H3/t8-/m1/s1.
What are the key properties of (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one?
(6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one has a molecular weight of 172.18 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4,6-dimethoxy-6-methyl-2H-pyran-5-one is sourced from PubChem (CID 162891934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).