C24H44 — CID 162891971
(5E,7R,9E)-2,6,10-trimethyl-7-[(3R)-3-methylpent-4-enyl]pentadeca-5,9-diene (PubChem CID 162891971) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is (5E,7R,9E)-2,6,10-trimethyl-7-[(3R)-3-methylpent-4-enyl]pentadeca-5,9-diene.
| Compound Name | (5E,7R,9E)-2,6,10-trimethyl-7-[(3R)-3-methylpent-4-enyl]pentadeca-5,9-diene |
|---|---|
| PubChem CID | 162891971 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | (5E,7R,9E)-2,6,10-trimethyl-7-[(3R)-3-methylpent-4-enyl]pentadeca-5,9-diene |
| SMILES | C=C[C@H](C)CC[C@H](C/C=C(\C)CCCCC)/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C24H44/c1-8-10-11-14-22(6)17-19-24(18-16-21(5)9-2)23(7)15-12-13-20(3)4/h9,15,17,20-21,24H,2,8,10-14,16,18-19H2,1,3-7H3/b22-17+,23-15+/t21-,24+/m0/s1 |
| InChIKey | VCXIEXNHNOVFNT-PNTPTAIXSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|