C16H28O — CID 162892116
(3R,4aR,5R,8aR)-5-methoxy-5,8a-dimethyl-3-prop-1-en-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 162892116) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (3R,4aR,5R,8aR)-5-methoxy-5,8a-dimethyl-3-prop-1-en-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | (3R,4aR,5R,8aR)-5-methoxy-5,8a-dimethyl-3-prop-1-en-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 162892116 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (3R,4aR,5R,8aR)-5-methoxy-5,8a-dimethyl-3-prop-1-en-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CCC[C@@](C)(OC)[C@@H]2C1 |
| InChI | InChI=1S/C16H28O/c1-12(2)13-7-10-15(3)8-6-9-16(4,17-5)14(15)11-13/h13-14H,1,6-11H2,2-5H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | SGRUNWZTMUZTDU-KLHDSHLOSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|