C25H27NO9 — CID 162892290
[2-[(2-acetyloxy-1,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)amino]-2-oxoethyl] acetate (PubChem CID 162892290) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is [2-[(2-acetyloxy-1,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)amino]-2-oxoethyl] acetate.
| Compound Name | [2-[(2-acetyloxy-1,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 162892290 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [2-[(2-acetyloxy-1,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)amino]-2-oxoethyl] acetate |
| SMILES | COc1cc2c(c(OC)c1OC(C)=O)-c1ccc(OC)c(=O)cc1C(NC(=O)COC(C)=O)CC2 |
| InChI | InChI=1S/C25H27NO9/c1-13(27)34-12-22(30)26-18-8-6-15-10-21(32-4)24(35-14(2)28)25(33-5)23(15)16-7-9-20(31-3)19(29)11-17(16)18/h7,9-11,18H,6,8,12H2,1-5H3,(H,26,30) |
| InChIKey | QVBYIIBWPDINIH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|