C27H38O4 — CID 162892485
2-[(2E,6E,8S,9S,10E)-8,9-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 162892485) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-[(2E,6E,8S,9S,10E)-8,9-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,8S,9S,10E)-8,9-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 162892485 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-[(2E,6E,8S,9S,10E)-8,9-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/[C@H](O)[C@@H](O)/C(C)=C/CC/C(C)=C/CC1=CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C27H38O4/c1-18(2)9-7-11-20(4)15-25(29)27(31)21(5)12-8-10-19(3)13-14-23-17-24(28)16-22(6)26(23)30/h9,12-13,15-17,25,27,29,31H,7-8,10-11,14H2,1-6H3/b19-13+,20-15+,21-12+/t25-,27-/m0/s1 |
| InChIKey | QVPQLWXTCHXBRT-LRXIOKGPSA-N |
| XLogP | 5.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|