C23H32O4 — CID 162892806
[(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate (PubChem CID 162892806) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate.
| Compound Name | [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162892806 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate |
| SMILES | COc1cc2c(cc1C(C)C)C(=O)C[C@H]1C(C)(C)C[C@@H](OC(C)=O)C[C@]21C |
| InChI | InChI=1S/C23H32O4/c1-13(2)16-8-17-18(9-20(16)26-7)23(6)12-15(27-14(3)24)11-22(4,5)21(23)10-19(17)25/h8-9,13,15,21H,10-12H2,1-7H3/t15-,21+,23-/m1/s1 |
| InChIKey | ABEYRUZXTWMTSC-LDLFBNOTSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |