About (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one
(2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one (PubChem CID 162893056) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 162893056 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one |
| SMILES | CC1=CC(=O)N[C@@H]1O |
| InChI | InChI=1S/C5H7NO2/c1-3-2-4(7)6-5(3)8/h2,5,8H,1H3,(H,6,7)/t5-/m1/s1 |
| InChIKey | CYAOUMDYSMFSPI-RXMQYKEDSA-N |
| XLogP | -0.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one?
The IUPAC name of (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one (CID 162893056) is (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one is CC1=CC(=O)N[C@@H]1O.
What is the InChIKey of (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one?
The InChIKey is CYAOUMDYSMFSPI-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H7NO2/c1-3-2-4(7)6-5(3)8/h2,5,8H,1H3,(H,6,7)/t5-/m1/s1.
What are the key properties of (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one?
(2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one has a molecular weight of 113.12 g/mol, XLogP of -0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxy-3-methyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 162893056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).