C20H32O — CID 162893224
4,8,15,15-tetramethyl-12-methylidenebicyclo[9.3.1]pentadeca-3,7-dien-1-ol (PubChem CID 162893224) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 4,8,15,15-tetramethyl-12-methylidenebicyclo[9.3.1]pentadeca-3,7-dien-1-ol.
| Compound Name | 4,8,15,15-tetramethyl-12-methylidenebicyclo[9.3.1]pentadeca-3,7-dien-1-ol |
|---|---|
| PubChem CID | 162893224 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4,8,15,15-tetramethyl-12-methylidenebicyclo[9.3.1]pentadeca-3,7-dien-1-ol |
| SMILES | C=C1CCC2(O)CC=C(C)CCC=C(C)CCC1C2(C)C |
| InChI | InChI=1S/C20H32O/c1-15-7-6-8-16(2)11-13-20(21)14-12-17(3)18(10-9-15)19(20,4)5/h7,11,18,21H,3,6,8-10,12-14H2,1-2,4-5H3 |
| InChIKey | CJLCDNWQBLJCEZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|