C26H28N2O3 — CID 162893230
(4R,12S,13R,14S,19S,21S)-8-methoxy-11-phenyl-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5(10),6,8,17-tetraen-14-ol (PubChem CID 162893230) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (4R,12S,13R,14S,19S,21S)-8-methoxy-11-phenyl-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5(10),6,8,17-tetraen-14-ol.
| Compound Name | (4R,12S,13R,14S,19S,21S)-8-methoxy-11-phenyl-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5(10),6,8,17-tetraen-14-ol |
|---|---|
| PubChem CID | 162893230 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (4R,12S,13R,14S,19S,21S)-8-methoxy-11-phenyl-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5(10),6,8,17-tetraen-14-ol |
| SMILES | COc1ccc2c(c1)N(c1ccccc1)[C@H]1[C@H]3[C@@H]4C[C@@H]5N(CC[C@@]251)CC4=CCO[C@@H]3O |
| InChI | InChI=1S/C26H28N2O3/c1-30-18-7-8-20-21(13-18)28(17-5-3-2-4-6-17)24-23-19-14-22-26(20,24)10-11-27(22)15-16(19)9-12-31-25(23)29/h2-9,13,19,22-25,29H,10-12,14-15H2,1H3/t19-,22+,23-,24+,25+,26-/m1/s1 |
| InChIKey | SFPUGLCORRDRNH-JVBAURMFSA-N |
| XLogP | 3.45 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|