C21H32O6 — CID 162893290
(1R,2S,3R,8S,10E,14R,15S)-2,3-dihydroxy-8-methoxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one (PubChem CID 162893290) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (1R,2S,3R,8S,10E,14R,15S)-2,3-dihydroxy-8-methoxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one.
| Compound Name | (1R,2S,3R,8S,10E,14R,15S)-2,3-dihydroxy-8-methoxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one |
|---|---|
| PubChem CID | 162893290 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1R,2S,3R,8S,10E,14R,15S)-2,3-dihydroxy-8-methoxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one |
| SMILES | CO[C@]12C/C(C)=C/CC[C@@H](C)[C@@H]3CC[C@@](C)(O3)[C@@H](O)[C@H](O)C1=C(C)C(=O)O2 |
| InChI | InChI=1S/C21H32O6/c1-12-7-6-8-13(2)15-9-10-20(4,26-15)18(23)17(22)16-14(3)19(24)27-21(16,11-12)25-5/h7,13,15,17-18,22-23H,6,8-11H2,1-5H3/b12-7+/t13-,15+,17-,18+,20-,21+/m1/s1 |
| InChIKey | XNCQSLQRDRRFCP-NYQPBYFUSA-N |
| XLogP | 2.63 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|