About 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one
7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one (PubChem CID 162893353) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one.
Molecular Properties
| Compound Name | 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one |
| PubChem CID | 162893353 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one |
| SMILES | COC(C)(CCC1C2CC(=C(C)C)C(=O)CC12C)OC |
| InChI | InChI=1S/C17H28O3/c1-11(2)12-9-14-13(16(14,3)10-15(12)18)7-8-17(4,19-5)20-6/h13-14H,7-10H2,1-6H3 |
| InChIKey | CTPMWRPBFHLHQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one?
The IUPAC name of 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one (CID 162893353) is 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one.
What is the SMILES notation for 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one?
The canonical SMILES for 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one is COC(C)(CCC1C2CC(=C(C)C)C(=O)CC12C)OC.
What is the InChIKey of 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one?
The InChIKey is CTPMWRPBFHLHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3/c1-11(2)12-9-14-13(16(14,3)10-15(12)18)7-8-17(4,19-5)20-6/h13-14H,7-10H2,1-6H3.
What are the key properties of 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one?
7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one has a molecular weight of 280.41 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one is sourced from PubChem (CID 162893353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).