C11H16O5 — CID 162893452
(4aR,5R,7aS)-7,7a-bis(hydroxymethyl)-5-methoxy-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one (PubChem CID 162893452) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (4aR,5R,7aS)-7,7a-bis(hydroxymethyl)-5-methoxy-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one.
| Compound Name | (4aR,5R,7aS)-7,7a-bis(hydroxymethyl)-5-methoxy-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 162893452 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (4aR,5R,7aS)-7,7a-bis(hydroxymethyl)-5-methoxy-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one |
| SMILES | CO[C@@H]1C=C(CO)[C@@]2(CO)COC(=O)C[C@@H]12 |
| InChI | InChI=1S/C11H16O5/c1-15-9-2-7(4-12)11(5-13)6-16-10(14)3-8(9)11/h2,8-9,12-13H,3-6H2,1H3/t8-,9+,11+/m0/s1 |
| InChIKey | GXSKJDWOJUWULB-IQJOONFLSA-N |
| XLogP | -0.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|