C17H20O9 — CID 162893503
methyl (1S,4aS,5R,7aS)-1,5-diacetyloxy-7-(acetyloxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162893503) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is methyl (1S,4aS,5R,7aS)-1,5-diacetyloxy-7-(acetyloxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,5R,7aS)-1,5-diacetyloxy-7-(acetyloxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162893503 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | methyl (1S,4aS,5R,7aS)-1,5-diacetyloxy-7-(acetyloxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC(C)=O)[C@@H]2C(COC(C)=O)=C[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C17H20O9/c1-8(18)23-6-11-5-13(25-9(2)19)15-12(16(21)22-4)7-24-17(14(11)15)26-10(3)20/h5,7,13-15,17H,6H2,1-4H3/t13-,14-,15+,17+/m1/s1 |
| InChIKey | CNYKDWSMWFETDQ-AIANPOQGSA-N |
| XLogP | 0.63 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|