C61H83N3O11S2 — CID 162893571
CID 162893571 (PubChem CID 162893571) has the molecular formula C61H83N3O11S2 and a molecular weight of 1098.48 g/mol.
| Compound Name | CID 162893571 |
|---|---|
| PubChem CID | 162893571 |
| Molecular Formula | C61H83N3O11S2 |
| Molecular Weight | 1098.48 g/mol |
| Exact Mass | 1097.55 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H](C)[C@@H]1O[C@H]1[C@@]1(O)CC=C[C@@H]2C[C@H]3C4=CC(=O)[C@@]5(C[C@@H](O)[C@@H](O)[C@@]6(CC[C@@H](Cn7ccnc7)C6)[C@]35C)[C@@H](O)SSC[C@H]3CCC[C@H](CO)[C@]35C(=O)N(C[C@@]53CCC[C@@H]3O)c3cc(O)cc(c3)CC[C@]23[C@@H]1CC[C@@]43O |
| InChI | InChI=1S/C61H83N3O11S2/c1-34(2)35(3)49-51(75-49)59(73)16-6-10-38-24-43-44-26-48(69)58(28-45(67)50(70)55(54(43,58)4)17-12-37(27-55)29-63-21-20-62-33-63)53(72)77-76-31-40-9-5-8-39(30-65)61(40)52(71)64(32-56(61)15-7-11-47(56)68)41-22-36(23-42(66)25-41)13-18-57(38)46(59)14-19-60(44,57)74/h6,10,20-23,25-26,33-35,37-40,43,45-47,49-51,53,65-68,70,72-74H,5,7-9,11-19,24,27-32H2,1-4H3/t35-,37-,38-,39-,40-,43+,45-,46+,47+,49+,50-,51-,53+,54+,55+,56-,57-,58+,59-,60-,61-/m1/s1 |
| InChIKey | RTSPEUSIAXZHTR-RRHIWXPFSA-N |
| XLogP | 7.14 |
| TPSA | 229.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|