C20H32O — CID 162893691
(1S,6R,11S,12S,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-11-ol (PubChem CID 162893691) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,6R,11S,12S,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-11-ol.
| Compound Name | (1S,6R,11S,12S,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-11-ol |
|---|---|
| PubChem CID | 162893691 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,6R,11S,12S,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-11-ol |
| SMILES | C=C1CCC[C@@H](C)CCC2=C(C)[C@@H]3[C@@H]1CC[C@]3(C)[C@@H](O)C2 |
| InChI | InChI=1S/C20H32O/c1-13-6-5-7-14(2)17-10-11-20(4)18(21)12-16(9-8-13)15(3)19(17)20/h13,17-19,21H,2,5-12H2,1,3-4H3/t13-,17-,18+,19-,20-/m1/s1 |
| InChIKey | AQKSOIFIWCVNCZ-DBTZYBQZSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|