C16H20O4 — CID 162894041
(3aR,4aS,5S,9aR)-3a-hydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4,5-dihydrobenzo[f][1]benzofuran-6-one (PubChem CID 162894041) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3aR,4aS,5S,9aR)-3a-hydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4,5-dihydrobenzo[f][1]benzofuran-6-one.
| Compound Name | (3aR,4aS,5S,9aR)-3a-hydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4,5-dihydrobenzo[f][1]benzofuran-6-one |
|---|---|
| PubChem CID | 162894041 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3aR,4aS,5S,9aR)-3a-hydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4,5-dihydrobenzo[f][1]benzofuran-6-one |
| SMILES | C=C1CO[C@]2(OC)C=C3C=CC(=O)[C@@H](C)[C@]3(C)C[C@@]12O |
| InChI | InChI=1S/C16H20O4/c1-10-8-20-16(19-4)7-12-5-6-13(17)11(2)14(12,3)9-15(10,16)18/h5-7,11,18H,1,8-9H2,2-4H3/t11-,14+,15-,16-/m1/s1 |
| InChIKey | HKZPSJMPWWKZDM-MSQAHXEGSA-N |
| XLogP | 1.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|