C18H30N6O — CID 162894157
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide (PubChem CID 162894157) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 162894157 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCC1CCCN2CCCCC12)C1(n2cnnn2)CCCCC1 |
| InChI | InChI=1S/C18H30N6O/c25-17(18(9-3-1-4-10-18)24-14-20-21-22-24)19-13-15-7-6-12-23-11-5-2-8-16(15)23/h14-16H,1-13H2,(H,19,25) |
| InChIKey | DHQZDECZJNWVTR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |