C30H54O4 — CID 162894420
(3S,6E,10E,14E,18E,22S)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-2,3,22,23-tetrol (PubChem CID 162894420) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is (3S,6E,10E,14E,18E,22S)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-2,3,22,23-tetrol.
| Compound Name | (3S,6E,10E,14E,18E,22S)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-2,3,22,23-tetrol |
|---|---|
| PubChem CID | 162894420 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | (3S,6E,10E,14E,18E,22S)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-2,3,22,23-tetrol |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CC[C@H](O)C(C)(C)O)CC/C=C(\C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H54O4/c1-23(15-11-17-25(3)19-21-27(31)29(5,6)33)13-9-10-14-24(2)16-12-18-26(4)20-22-28(32)30(7,8)34/h13-14,17-18,27-28,31-34H,9-12,15-16,19-22H2,1-8H3/b23-13+,24-14+,25-17+,26-18+/t27-,28-/m0/s1 |
| InChIKey | NPWAQSYSDCQSKY-OQSIWNGOSA-N |
| XLogP | 6.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|