C15H24O4 — CID 162894993
methyl (4R)-4-[[(2S)-2-hydroxy-2-methyl-5-oxocyclopentylidene]methyl]-5-methylhexanoate (PubChem CID 162894993) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl (4R)-4-[[(2S)-2-hydroxy-2-methyl-5-oxocyclopentylidene]methyl]-5-methylhexanoate.
| Compound Name | methyl (4R)-4-[[(2S)-2-hydroxy-2-methyl-5-oxocyclopentylidene]methyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 162894993 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | methyl (4R)-4-[[(2S)-2-hydroxy-2-methyl-5-oxocyclopentylidene]methyl]-5-methylhexanoate |
| SMILES | COC(=O)CC[C@@H](C=C1C(=O)CC[C@]1(C)O)C(C)C |
| InChI | InChI=1S/C15H24O4/c1-10(2)11(5-6-14(17)19-4)9-12-13(16)7-8-15(12,3)18/h9-11,18H,5-8H2,1-4H3/t11-,15-/m0/s1 |
| InChIKey | LBKYKMRIFPZXPI-NHYWBVRUSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|