C25H28O11 — CID 162895346
2-[4-[6-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162895346) has the molecular formula C25H28O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is 2-[4-[6-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-[6-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162895346 |
| Molecular Formula | C25H28O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[4-[6-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1OC(Oc2ccc(C3OCC4C(c5ccc6c(c5)OCO6)OCC34)cc2O)C(O)C(O)C1O |
| InChI | InChI=1S/C25H28O11/c26-7-19-20(28)21(29)22(30)25(36-19)35-16-3-1-11(5-15(16)27)23-13-8-32-24(14(13)9-31-23)12-2-4-17-18(6-12)34-10-33-17/h1-6,13-14,19-30H,7-10H2 |
| InChIKey | WRXFNBLQLDCLSV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |