C21H30O4 — CID 162895354
[(4aR,7R,8aR)-7-(3-methoxy-3-oxoprop-1-en-2-yl)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 162895354) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(4aR,7R,8aR)-7-(3-methoxy-3-oxoprop-1-en-2-yl)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(4aR,7R,8aR)-7-(3-methoxy-3-oxoprop-1-en-2-yl)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162895354 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(4aR,7R,8aR)-7-(3-methoxy-3-oxoprop-1-en-2-yl)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CCC=C(COC(=O)/C(C)=C/C)[C@@H]2C1 |
| InChI | InChI=1S/C21H30O4/c1-6-14(2)19(22)25-13-17-8-7-10-21(4)11-9-16(12-18(17)21)15(3)20(23)24-5/h6,8,16,18H,3,7,9-13H2,1-2,4-5H3/b14-6+/t16-,18+,21-/m1/s1 |
| InChIKey | XZOUGSIJROFAMB-DNWBUVRSSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|