About 3,4-dihydroindolo[2,3-a]quinolizine
3,4-dihydroindolo[2,3-a]quinolizine (PubChem CID 162895954) has the molecular formula C15H12N2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 3,4-dihydroindolo[2,3-a]quinolizine.
Molecular Properties
| Compound Name | 3,4-dihydroindolo[2,3-a]quinolizine |
| PubChem CID | 162895954 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3,4-dihydroindolo[2,3-a]quinolizine |
| SMILES | C1=Cc2c3nc4ccccc4c-3ccn2CC1 |
| InChI | InChI=1S/C15H12N2/c1-2-6-13-11(5-1)12-8-10-17-9-4-3-7-14(17)15(12)16-13/h1-3,5-8,10H,4,9H2 |
| InChIKey | BUMQWCMXRRDROK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydroindolo[2,3-a]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroindolo[2,3-a]quinolizine?
The IUPAC name of 3,4-dihydroindolo[2,3-a]quinolizine (CID 162895954) is 3,4-dihydroindolo[2,3-a]quinolizine.
What is the SMILES notation for 3,4-dihydroindolo[2,3-a]quinolizine?
The canonical SMILES for 3,4-dihydroindolo[2,3-a]quinolizine is C1=Cc2c3nc4ccccc4c-3ccn2CC1.
What is the InChIKey of 3,4-dihydroindolo[2,3-a]quinolizine?
The InChIKey is BUMQWCMXRRDROK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2/c1-2-6-13-11(5-1)12-8-10-17-9-4-3-7-14(17)15(12)16-13/h1-3,5-8,10H,4,9H2.
What are the key properties of 3,4-dihydroindolo[2,3-a]quinolizine?
3,4-dihydroindolo[2,3-a]quinolizine has a molecular weight of 220.28 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroindolo[2,3-a]quinolizine is sourced from PubChem (CID 162895954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).