C20H36O4 — CID 162896438
(2E,6E,10E,14S)-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10-triene-1,14,15-triol (PubChem CID 162896438) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (2E,6E,10E,14S)-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10-triene-1,14,15-triol.
| Compound Name | (2E,6E,10E,14S)-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10-triene-1,14,15-triol |
|---|---|
| PubChem CID | 162896438 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (2E,6E,10E,14S)-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10-triene-1,14,15-triol |
| SMILES | C/C(=C\CC/C(=C\CO)CO)CC/C=C(\C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C20H36O4/c1-16(9-6-10-18(15-22)13-14-21)7-5-8-17(2)11-12-19(23)20(3,4)24/h8-9,13,19,21-24H,5-7,10-12,14-15H2,1-4H3/b16-9+,17-8+,18-13+/t19-/m0/s1 |
| InChIKey | OUNTWVOXOAIJPN-JIKPFOECSA-N |
| XLogP | 3.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|