C14H26O3 — CID 162896512
(1R,2R,5S)-2-[(3R)-3-hydroxybut-1-enyl]-1,3,3,5-tetramethylcyclohexane-1,2-diol (PubChem CID 162896512) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (1R,2R,5S)-2-[(3R)-3-hydroxybut-1-enyl]-1,3,3,5-tetramethylcyclohexane-1,2-diol.
| Compound Name | (1R,2R,5S)-2-[(3R)-3-hydroxybut-1-enyl]-1,3,3,5-tetramethylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 162896512 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (1R,2R,5S)-2-[(3R)-3-hydroxybut-1-enyl]-1,3,3,5-tetramethylcyclohexane-1,2-diol |
| SMILES | C[C@H]1CC(C)(C)[C@](O)(C=C[C@@H](C)O)[C@](C)(O)C1 |
| InChI | InChI=1S/C14H26O3/c1-10-8-12(3,4)14(17,7-6-11(2)15)13(5,16)9-10/h6-7,10-11,15-17H,8-9H2,1-5H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | NWZPFJRLUUDDIH-OIMNJJJWSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|