C66H94N4O9 — CID 162896655
CID 162896655 (PubChem CID 162896655) has the molecular formula C66H94N4O9 and a molecular weight of 1087.50 g/mol.
| Compound Name | CID 162896655 |
|---|---|
| PubChem CID | 162896655 |
| Molecular Formula | C66H94N4O9 |
| Molecular Weight | 1087.50 g/mol |
| Exact Mass | 1086.70 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1C[C@H]2C=C[C@@H]1C[C@@H](O)C[C@@]1(CCC[C@]13CCO[C@@]1(CCC[C@H](CNC)C1)C3)C/N=C(\N)NCC[C@@H]1[C@@H](CO)CCC[C@@H]1Oc1cc(ccc1O)[C@@H]1Oc3cc(OC)c4c(c3C[C@H]1O)[C@@H]2Cc1cc(O)c(CC(C)C)cc1-4 |
| InChI | InChI=1S/C66H94N4O9/c1-6-41-25-43-14-13-42(41)26-48(72)34-65(19-9-18-64(65)21-23-77-66(37-64)20-8-10-40(33-66)35-68-4)38-70-63(67)69-22-17-49-45(36-71)11-7-12-56(49)78-58-30-44(15-16-53(58)73)62-55(75)31-52-57(79-62)32-59(76-5)61-51-28-47(24-39(2)3)54(74)29-46(51)27-50(43)60(52)61/h13-16,28-30,32,39-43,45,48-50,55-56,62,68,71-75H,6-12,17-27,31,33-38H2,1-5H3,(H3,67,69,70)/t40-,41+,42+,43+,45+,48+,49+,50+,55+,56-,62-,64+,65-,66+/m0/s1 |
| InChIKey | UEIUTVBMWFQCSU-HGNNCOKOSA-N |
| XLogP | 10.59 |
| TPSA | 200.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 79 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.50 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|