C14H24O14 — CID 162896865
(2S,3R,4S,5R,6S)-6-[(2S,3S,4S,5S,6S,7R)-1,3,4,5,6,7-hexahydroxy-8-oxooctan-2-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162896865) has the molecular formula C14H24O14 and a molecular weight of 416.33 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-[(2S,3S,4S,5S,6S,7R)-1,3,4,5,6,7-hexahydroxy-8-oxooctan-2-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5R,6S)-6-[(2S,3S,4S,5S,6S,7R)-1,3,4,5,6,7-hexahydroxy-8-oxooctan-2-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162896865 |
| Molecular Formula | C14H24O14 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-[(2S,3S,4S,5S,6S,7R)-1,3,4,5,6,7-hexahydroxy-8-oxooctan-2-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H](CO)O[C@H]1O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O14/c15-1-3(17)5(18)7(20)8(21)6(19)4(2-16)27-14-11(24)9(22)10(23)12(28-14)13(25)26/h1,3-12,14,16-24H,2H2,(H,25,26)/t3-,4-,5+,6+,7+,8+,9-,10+,11+,12-,14-/m0/s1 |
| InChIKey | SVOJCMBCUXIIPI-LIBMMSEPSA-N |
| XLogP | -6.74 |
| TPSA | 254.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|