C26H34O11 — CID 162896954
(2R,3S,4S,5R)-2-[[(1R,2S,3S)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 162896954) has the molecular formula C26H34O11 and a molecular weight of 522.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[[(1R,2S,3S)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-[[(1R,2S,3S)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162896954 |
| Molecular Formula | C26H34O11 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (2R,3S,4S,5R)-2-[[(1R,2S,3S)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | COc1cc2c(cc1O)[C@@H](c1cc(OC)c(O)c(OC)c1)[C@H](CO[C@@H]1OC[C@@H](O)[C@H](O)[C@@H]1O)[C@@H](CO)C2 |
| InChI | InChI=1S/C26H34O11/c1-33-19-5-12-4-14(9-27)16(10-36-26-25(32)23(30)18(29)11-37-26)22(15(12)8-17(19)28)13-6-20(34-2)24(31)21(7-13)35-3/h5-8,14,16,18,22-23,25-32H,4,9-11H2,1-3H3/t14-,16-,18-,22-,23+,25+,26-/m1/s1 |
| InChIKey | QOKISIDHCPDXMC-GNDDEHQTSA-N |
| XLogP | 0.49 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |