C15H28 — CID 162897035
(2Z,4E,7R)-3,7,11-trimethyldodeca-2,4-diene (PubChem CID 162897035) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (2Z,4E,7R)-3,7,11-trimethyldodeca-2,4-diene.
| Compound Name | (2Z,4E,7R)-3,7,11-trimethyldodeca-2,4-diene |
|---|---|
| PubChem CID | 162897035 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (2Z,4E,7R)-3,7,11-trimethyldodeca-2,4-diene |
| SMILES | C/C=C(C)\C=C\C[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C15H28/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,8,10,13,15H,7,9,11-12H2,1-5H3/b10-8+,14-6-/t15-/m1/s1 |
| InChIKey | QUFVBBANWSSNQF-VPHKHRPNSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|