C20H30O4 — CID 162897720
(1S,4aR,5S,8aR)-5-[2-[(2R,3S)-3-formyl-2-methyloxiran-2-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid (PubChem CID 162897720) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,4aR,5S,8aR)-5-[2-[(2R,3S)-3-formyl-2-methyloxiran-2-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid.
| Compound Name | (1S,4aR,5S,8aR)-5-[2-[(2R,3S)-3-formyl-2-methyloxiran-2-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162897720 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,4aR,5S,8aR)-5-[2-[(2R,3S)-3-formyl-2-methyloxiran-2-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1CC[C@@]1(C)O[C@@H]1C=O |
| InChI | InChI=1S/C20H30O4/c1-13-6-7-15-18(2,9-5-10-19(15,3)17(22)23)14(13)8-11-20(4)16(12-21)24-20/h12,14-16H,1,5-11H2,2-4H3,(H,22,23)/t14-,15+,16+,18+,19-,20+/m0/s1 |
| InChIKey | VVDIMJXOUCRZDG-QBCCGUPOSA-N |
| XLogP | 3.99 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|