C15H20O11 — CID 162898204
3-[[(2R,3S,4S,5R,6S)-6-[(5R)-2,5-dimethyl-4-oxofuran-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid (PubChem CID 162898204) has the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. Its IUPAC name is 3-[[(2R,3S,4S,5R,6S)-6-[(5R)-2,5-dimethyl-4-oxofuran-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[(2R,3S,4S,5R,6S)-6-[(5R)-2,5-dimethyl-4-oxofuran-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 162898204 |
| Molecular Formula | C15H20O11 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[(5R)-2,5-dimethyl-4-oxofuran-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
| SMILES | CC1=C(O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]2O)C(=O)[C@@H](C)O1 |
| InChI | InChI=1S/C15H20O11/c1-5-10(19)14(6(2)24-5)26-15-13(22)12(21)11(20)7(25-15)4-23-9(18)3-8(16)17/h5,7,11-13,15,20-22H,3-4H2,1-2H3,(H,16,17)/t5-,7-,11-,12+,13-,15+/m1/s1 |
| InChIKey | QJYOBEMAMLWZTF-JNOHPBAZSA-N |
| XLogP | -1.95 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|