C22H30O4 — CID 162898552
4-hydroxy-3-[3-methyl-5-[(1S,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]benzoic acid (PubChem CID 162898552) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-hydroxy-3-[3-methyl-5-[(1S,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]benzoic acid.
| Compound Name | 4-hydroxy-3-[3-methyl-5-[(1S,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]benzoic acid |
|---|---|
| PubChem CID | 162898552 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 4-hydroxy-3-[3-methyl-5-[(1S,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]benzoic acid |
| SMILES | CC(=CCc1cc(C(=O)O)ccc1O)CC[C@@]1(C)[C@H](C)CCC(=O)[C@H]1C |
| InChI | InChI=1S/C22H30O4/c1-14(5-7-17-13-18(21(25)26)8-10-20(17)24)11-12-22(4)15(2)6-9-19(23)16(22)3/h5,8,10,13,15-16,24H,6-7,9,11-12H2,1-4H3,(H,25,26)/t15-,16-,22+/m1/s1 |
| InChIKey | XTHUWDOULQJWNT-MCFFVMPBSA-N |
| XLogP | 5.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|