C24H30O9 — CID 162898605
[(4R,6Z,8R,10S,11E)-8-acetyloxy-3-(acetyloxymethyl)-10-hydroxy-6,10-dimethyl-2-oxo-4,5,8,9-tetrahydrocyclodeca[b]furan-4-yl] (E)-2-methylbut-2-enoate (PubChem CID 162898605) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(4R,6Z,8R,10S,11E)-8-acetyloxy-3-(acetyloxymethyl)-10-hydroxy-6,10-dimethyl-2-oxo-4,5,8,9-tetrahydrocyclodeca[b]furan-4-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(4R,6Z,8R,10S,11E)-8-acetyloxy-3-(acetyloxymethyl)-10-hydroxy-6,10-dimethyl-2-oxo-4,5,8,9-tetrahydrocyclodeca[b]furan-4-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162898605 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(4R,6Z,8R,10S,11E)-8-acetyloxy-3-(acetyloxymethyl)-10-hydroxy-6,10-dimethyl-2-oxo-4,5,8,9-tetrahydrocyclodeca[b]furan-4-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1C/C(C)=C\[C@H](OC(C)=O)C[C@](C)(O)/C=C2/OC(=O)C(COC(C)=O)=C21 |
| InChI | InChI=1S/C24H30O9/c1-7-14(3)22(27)32-19-9-13(2)8-17(31-16(5)26)10-24(6,29)11-20-21(19)18(23(28)33-20)12-30-15(4)25/h7-8,11,17,19,29H,9-10,12H2,1-6H3/b13-8-,14-7+,20-11+/t17-,19+,24-/m0/s1 |
| InChIKey | WJLVBNZNHMFQIQ-WZFLMHRNSA-N |
| XLogP | 2.59 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|