C15H21Br2ClO3 — CID 162898664
(1R,3S,4R,6R,8S,9S,10R,12S)-3,8-dibromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-ol (PubChem CID 162898664) has the molecular formula C15H21Br2ClO3 and a molecular weight of 444.59 g/mol. Its IUPAC name is (1R,3S,4R,6R,8S,9S,10R,12S)-3,8-dibromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-ol.
| Compound Name | (1R,3S,4R,6R,8S,9S,10R,12S)-3,8-dibromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-ol |
|---|---|
| PubChem CID | 162898664 |
| Molecular Formula | C15H21Br2ClO3 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | (1R,3S,4R,6R,8S,9S,10R,12S)-3,8-dibromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-ol |
| SMILES | CC1(C)[C@@]2(Br)O[C@@H]3C[C@@](C)(Cl)[C@@H](Br)C[C@]31[C@]1(C)O[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C15H21Br2ClO3/c1-11(2)14-5-7(16)12(3,18)6-8(14)20-15(11,17)9(19)10-13(14,4)21-10/h7-10,19H,5-6H2,1-4H3/t7-,8+,9-,10+,12+,13+,14-,15-/m0/s1 |
| InChIKey | GQTRVJJQEJXMFF-NYVSIKGMSA-N |
| XLogP | 3.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|