C16H16O5 — CID 162898862
3-phenyl-1-(2,4,5-trihydroxy-3-methoxyphenyl)propan-1-one (PubChem CID 162898862) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-phenyl-1-(2,4,5-trihydroxy-3-methoxyphenyl)propan-1-one.
| Compound Name | 3-phenyl-1-(2,4,5-trihydroxy-3-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 162898862 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-phenyl-1-(2,4,5-trihydroxy-3-methoxyphenyl)propan-1-one |
| SMILES | COc1c(O)c(O)cc(C(=O)CCc2ccccc2)c1O |
| InChI | InChI=1S/C16H16O5/c1-21-16-14(19)11(9-13(18)15(16)20)12(17)8-7-10-5-3-2-4-6-10/h2-6,9,18-20H,7-8H2,1H3 |
| InChIKey | JNGLPVFMAAXRRH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|