About [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate
[1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 162898995) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate.
Molecular Properties
| Compound Name | [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate |
| PubChem CID | 162898995 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | CC(=O)OC1CC2CCC1(C)C2(C)CCC=C(C)C |
| InChI | InChI=1S/C17H28O2/c1-12(2)7-6-9-16(4)14-8-10-17(16,5)15(11-14)19-13(3)18/h7,14-15H,6,8-11H2,1-5H3 |
| InChIKey | HRFOLYMTTOKYPM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate?
The IUPAC name of [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate (CID 162898995) is [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate.
What is the SMILES notation for [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate?
The canonical SMILES for [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate is CC(=O)OC1CC2CCC1(C)C2(C)CCC=C(C)C.
What is the InChIKey of [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate?
The InChIKey is HRFOLYMTTOKYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-12(2)7-6-9-16(4)14-8-10-17(16,5)15(11-14)19-13(3)18/h7,14-15H,6,8-11H2,1-5H3.
What are the key properties of [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate?
[1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate has a molecular weight of 264.41 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,7-dimethyl-7-(4-methylpent-3-enyl)-2-bicyclo[2.2.1]heptanyl] acetate is sourced from PubChem (CID 162898995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).