C16H26O3 — CID 162899911
(3S,5R,6R)-3,5-dimethyl-6-[(E,6R)-6-methyl-7-oxooct-2-en-2-yl]oxan-2-one (PubChem CID 162899911) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (3S,5R,6R)-3,5-dimethyl-6-[(E,6R)-6-methyl-7-oxooct-2-en-2-yl]oxan-2-one.
| Compound Name | (3S,5R,6R)-3,5-dimethyl-6-[(E,6R)-6-methyl-7-oxooct-2-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 162899911 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3S,5R,6R)-3,5-dimethyl-6-[(E,6R)-6-methyl-7-oxooct-2-en-2-yl]oxan-2-one |
| SMILES | CC(=O)[C@H](C)CC/C=C(\C)[C@@H]1OC(=O)[C@@H](C)C[C@H]1C |
| InChI | InChI=1S/C16H26O3/c1-10(14(5)17)7-6-8-11(2)15-12(3)9-13(4)16(18)19-15/h8,10,12-13,15H,6-7,9H2,1-5H3/b11-8+/t10-,12-,13+,15+/m1/s1 |
| InChIKey | HVAVVMZBLGYKBB-SDBMDCLLSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|